ChemNet > CAS > 175277-53-9 6-[(4-chlorophenyl)thio]imidazo[2,1-b][1,3]thiazole-5-carbaldehyde
175277-53-9 6-[(4-chlorophenyl)thio]imidazo[2,1-b][1,3]thiazole-5-carbaldehyde
| product Name |
6-[(4-chlorophenyl)thio]imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| CAS No |
175277-53-9 |
| Synonyms |
6-(4-Chlorophenylthio)imidazo[2,1-b]thiazole-5-carboxaldehyde; 6-[(4-chlorophenyl)sulfanyl]imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| Molecular Formula |
C12H7ClN2OS2 |
| Molecular Weight |
294.7798 |
| InChI |
InChI=1/C12H7ClN2OS2/c13-8-1-3-9(4-2-8)18-11-10(7-16)15-5-6-17-12(15)14-11/h1-7H |
| Molecular Structure |
![175277-53-9 6-[(4-chlorophenyl)thio]imidazo[2,1-b][1,3]thiazole-5-carbaldehyde](https://images-a.chemnet.com/suppliers/chembase/cas/cas175277-53-9.gif)
|
| Density |
1.54g/cm3 |
| Melting point |
139℃ |
| Refractive index |
1.753 |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
